C17H19ClO — CID 114980972
1-(5-chloro-2-methylphenyl)-2-(4-ethylphenyl)ethanol (PubChem CID 114980972) has the molecular formula C17H19ClO and a molecular weight of 274.79 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-2-(4-ethylphenyl)ethanol.
| Compound Name | 1-(5-chloro-2-methylphenyl)-2-(4-ethylphenyl)ethanol |
|---|---|
| PubChem CID | 114980972 |
| Molecular Formula | C17H19ClO |
| Molecular Weight | 274.79 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-2-(4-ethylphenyl)ethanol |
| SMILES | CCc1ccc(CC(O)c2cc(Cl)ccc2C)cc1 |
| InChI | InChI=1S/C17H19ClO/c1-3-13-5-7-14(8-6-13)10-17(19)16-11-15(18)9-4-12(16)2/h4-9,11,17,19H,3,10H2,1-2H3 |
| InChIKey | AVPIDIUAIRRRGX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.79 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |