C14H10ClF3O — CID 81263221
1-(3-chloro-2-fluorophenyl)-2-(3,4-difluorophenyl)ethanol (PubChem CID 81263221) has the molecular formula C14H10ClF3O and a molecular weight of 286.68 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)-2-(3,4-difluorophenyl)ethanol.
| Compound Name | 1-(3-chloro-2-fluorophenyl)-2-(3,4-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 81263221 |
| Molecular Formula | C14H10ClF3O |
| Molecular Weight | 286.68 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)-2-(3,4-difluorophenyl)ethanol |
| SMILES | OC(Cc1ccc(F)c(F)c1)c1cccc(Cl)c1F |
| InChI | InChI=1S/C14H10ClF3O/c15-10-3-1-2-9(14(10)18)13(19)7-8-4-5-11(16)12(17)6-8/h1-6,13,19H,7H2 |
| InChIKey | VBSJHEDWGBITAU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.68 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |