C15H12ClF3O — CID 82920732
1-(3-chloro-2-fluorophenyl)-3-(3,4-difluorophenyl)propan-2-ol (PubChem CID 82920732) has the molecular formula C15H12ClF3O and a molecular weight of 300.71 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)-3-(3,4-difluorophenyl)propan-2-ol.
| Compound Name | 1-(3-chloro-2-fluorophenyl)-3-(3,4-difluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 82920732 |
| Molecular Formula | C15H12ClF3O |
| Molecular Weight | 300.71 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)-3-(3,4-difluorophenyl)propan-2-ol |
| SMILES | OC(Cc1ccc(F)c(F)c1)Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C15H12ClF3O/c16-12-3-1-2-10(15(12)19)8-11(20)6-9-4-5-13(17)14(18)7-9/h1-5,7,11,20H,6,8H2 |
| InChIKey | QLQDWDDJDNUUKV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.71 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |