C16H15BrClFO2 — CID 82788489
1-(3-bromo-4-methoxyphenyl)-3-(3-chloro-2-fluorophenyl)propan-2-ol (PubChem CID 82788489) has the molecular formula C16H15BrClFO2 and a molecular weight of 373.65 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)-3-(3-chloro-2-fluorophenyl)propan-2-ol.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)-3-(3-chloro-2-fluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 82788489 |
| Molecular Formula | C16H15BrClFO2 |
| Molecular Weight | 373.65 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)-3-(3-chloro-2-fluorophenyl)propan-2-ol |
| SMILES | COc1ccc(CC(O)Cc2cccc(Cl)c2F)cc1Br |
| InChI | InChI=1S/C16H15BrClFO2/c1-21-15-6-5-10(8-13(15)17)7-12(20)9-11-3-2-4-14(18)16(11)19/h2-6,8,12,20H,7,9H2,1H3 |
| InChIKey | OINVLLGCPGQINW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.65 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |