C12H17BrO — CID 83988264
1-(2-bromo-4,5-dimethylphenyl)butan-1-ol (PubChem CID 83988264) has the molecular formula C12H17BrO and a molecular weight of 257.17 g/mol. Its IUPAC name is 1-(2-bromo-4,5-dimethylphenyl)butan-1-ol.
| Compound Name | 1-(2-bromo-4,5-dimethylphenyl)butan-1-ol |
|---|---|
| PubChem CID | 83988264 |
| Molecular Formula | C12H17BrO |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 1-(2-bromo-4,5-dimethylphenyl)butan-1-ol |
| SMILES | CCCC(O)c1cc(C)c(C)cc1Br |
| InChI | InChI=1S/C12H17BrO/c1-4-5-12(14)10-6-8(2)9(3)7-11(10)13/h6-7,12,14H,4-5H2,1-3H3 |
| InChIKey | PHBKFHPOUCNRHZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |