C10H9Br2F3O — CID 81473324
1-(2,5-dibromo-4-methylphenyl)-3,3,3-trifluoropropan-1-ol (PubChem CID 81473324) has the molecular formula C10H9Br2F3O and a molecular weight of 361.98 g/mol. Its IUPAC name is 1-(2,5-dibromo-4-methylphenyl)-3,3,3-trifluoropropan-1-ol.
| Compound Name | 1-(2,5-dibromo-4-methylphenyl)-3,3,3-trifluoropropan-1-ol |
|---|---|
| PubChem CID | 81473324 |
| Molecular Formula | C10H9Br2F3O |
| Molecular Weight | 361.98 g/mol |
| Exact Mass | 359.90 |
| IUPAC Name | 1-(2,5-dibromo-4-methylphenyl)-3,3,3-trifluoropropan-1-ol |
| SMILES | Cc1cc(Br)c(C(O)CC(F)(F)F)cc1Br |
| InChI | InChI=1S/C10H9Br2F3O/c1-5-2-8(12)6(3-7(5)11)9(16)4-10(13,14)15/h2-3,9,16H,4H2,1H3 |
| InChIKey | GSNDWZNXJQDGHU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.98 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |