C9H6Br2ClF3 — CID 81473344
1,4-dibromo-2-(1-chloro-2,2,2-trifluoroethyl)-5-methylbenzene (PubChem CID 81473344) has the molecular formula C9H6Br2ClF3 and a molecular weight of 366.40 g/mol. Its IUPAC name is 1,4-dibromo-2-(1-chloro-2,2,2-trifluoroethyl)-5-methylbenzene.
| Compound Name | 1,4-dibromo-2-(1-chloro-2,2,2-trifluoroethyl)-5-methylbenzene |
|---|---|
| PubChem CID | 81473344 |
| Molecular Formula | C9H6Br2ClF3 |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 363.85 |
| IUPAC Name | 1,4-dibromo-2-(1-chloro-2,2,2-trifluoroethyl)-5-methylbenzene |
| SMILES | Cc1cc(Br)c(C(Cl)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C9H6Br2ClF3/c1-4-2-7(11)5(3-6(4)10)8(12)9(13,14)15/h2-3,8H,1H3 |
| InChIKey | XTYFRIAQORZETJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|