C14H9Br2ClF2 — CID 81473564
1,4-dibromo-2-[chloro-(3,5-difluorophenyl)methyl]-5-methylbenzene (PubChem CID 81473564) has the molecular formula C14H9Br2ClF2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 1,4-dibromo-2-[chloro-(3,5-difluorophenyl)methyl]-5-methylbenzene.
| Compound Name | 1,4-dibromo-2-[chloro-(3,5-difluorophenyl)methyl]-5-methylbenzene |
|---|---|
| PubChem CID | 81473564 |
| Molecular Formula | C14H9Br2ClF2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 407.87 |
| IUPAC Name | 1,4-dibromo-2-[chloro-(3,5-difluorophenyl)methyl]-5-methylbenzene |
| SMILES | Cc1cc(Br)c(C(Cl)c2cc(F)cc(F)c2)cc1Br |
| InChI | InChI=1S/C14H9Br2ClF2/c1-7-2-13(16)11(6-12(7)15)14(17)8-3-9(18)5-10(19)4-8/h2-6,14H,1H3 |
| InChIKey | BJGUGJWTDDAHDV-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|