C15H12Br2ClF — CID 81472720
1,4-dibromo-2-[1-chloro-2-(4-fluorophenyl)ethyl]-5-methylbenzene (PubChem CID 81472720) has the molecular formula C15H12Br2ClF and a molecular weight of 406.52 g/mol. Its IUPAC name is 1,4-dibromo-2-[1-chloro-2-(4-fluorophenyl)ethyl]-5-methylbenzene.
| Compound Name | 1,4-dibromo-2-[1-chloro-2-(4-fluorophenyl)ethyl]-5-methylbenzene |
|---|---|
| PubChem CID | 81472720 |
| Molecular Formula | C15H12Br2ClF |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 403.90 |
| IUPAC Name | 1,4-dibromo-2-[1-chloro-2-(4-fluorophenyl)ethyl]-5-methylbenzene |
| SMILES | Cc1cc(Br)c(C(Cl)Cc2ccc(F)cc2)cc1Br |
| InChI | InChI=1S/C15H12Br2ClF/c1-9-6-14(17)12(8-13(9)16)15(18)7-10-2-4-11(19)5-3-10/h2-6,8,15H,7H2,1H3 |
| InChIKey | IWUQCXBHAKHVSQ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|