C12H15Br2Cl — CID 81473878
1,4-dibromo-2-(1-chloropentyl)-5-methylbenzene (PubChem CID 81473878) has the molecular formula C12H15Br2Cl and a molecular weight of 354.51 g/mol. Its IUPAC name is 1,4-dibromo-2-(1-chloropentyl)-5-methylbenzene.
| Compound Name | 1,4-dibromo-2-(1-chloropentyl)-5-methylbenzene |
|---|---|
| PubChem CID | 81473878 |
| Molecular Formula | C12H15Br2Cl |
| Molecular Weight | 354.51 g/mol |
| Exact Mass | 351.92 |
| IUPAC Name | 1,4-dibromo-2-(1-chloropentyl)-5-methylbenzene |
| SMILES | CCCCC(Cl)c1cc(Br)c(C)cc1Br |
| InChI | InChI=1S/C12H15Br2Cl/c1-3-4-5-12(15)9-7-10(13)8(2)6-11(9)14/h6-7,12H,3-5H2,1-2H3 |
| InChIKey | QJNDORCJGRAMNU-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.51 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|