C16H22BrClO2 — CID 114753517
7-bromo-8-(1-chloroheptyl)-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 114753517) has the molecular formula C16H22BrClO2 and a molecular weight of 361.71 g/mol. Its IUPAC name is 7-bromo-8-(1-chloroheptyl)-3,4-dihydro-2H-1,5-benzodioxepine.
| Compound Name | 7-bromo-8-(1-chloroheptyl)-3,4-dihydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 114753517 |
| Molecular Formula | C16H22BrClO2 |
| Molecular Weight | 361.71 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 7-bromo-8-(1-chloroheptyl)-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | CCCCCCC(Cl)c1cc2c(cc1Br)OCCCO2 |
| InChI | InChI=1S/C16H22BrClO2/c1-2-3-4-5-7-14(18)12-10-15-16(11-13(12)17)20-9-6-8-19-15/h10-11,14H,2-9H2,1H3 |
| InChIKey | WFJGTTQBFMUKHW-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.71 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|