About 1-bromo-4-(1-chloroheptyl)-2,5-dimethylbenzene
1-bromo-4-(1-chloroheptyl)-2,5-dimethylbenzene (PubChem CID 114753647) has the molecular formula C15H22BrCl
and a molecular weight of 317.70 g/mol. Its IUPAC name is 1-bromo-4-(1-chloroheptyl)-2,5-dimethylbenzene.
Molecular Properties
| Compound Name | 1-bromo-4-(1-chloroheptyl)-2,5-dimethylbenzene |
| PubChem CID | 114753647 |
| Molecular Formula | C15H22BrCl |
| Molecular Weight | 317.70 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 1-bromo-4-(1-chloroheptyl)-2,5-dimethylbenzene |
| SMILES | CCCCCCC(Cl)c1cc(C)c(Br)cc1C |
| InChI | InChI=1S/C15H22BrCl/c1-4-5-6-7-8-15(17)13-9-12(3)14(16)10-11(13)2/h9-10,15H,4-8H2,1-3H3 |
| InChIKey | VSVBBNPRIOYGQR-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.70 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-(1-chloroheptyl)-2,5-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-(1-chloroheptyl)-2,5-dimethylbenzene?
The IUPAC name of 1-bromo-4-(1-chloroheptyl)-2,5-dimethylbenzene (CID 114753647) is 1-bromo-4-(1-chloroheptyl)-2,5-dimethylbenzene.
What is the SMILES notation for 1-bromo-4-(1-chloroheptyl)-2,5-dimethylbenzene?
The canonical SMILES for 1-bromo-4-(1-chloroheptyl)-2,5-dimethylbenzene is CCCCCCC(Cl)c1cc(C)c(Br)cc1C.
What is the InChIKey of 1-bromo-4-(1-chloroheptyl)-2,5-dimethylbenzene?
The InChIKey is VSVBBNPRIOYGQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22BrCl/c1-4-5-6-7-8-15(17)13-9-12(3)14(16)10-11(13)2/h9-10,15H,4-8H2,1-3H3.
What are the key properties of 1-bromo-4-(1-chloroheptyl)-2,5-dimethylbenzene?
1-bromo-4-(1-chloroheptyl)-2,5-dimethylbenzene has a molecular weight of 317.70 g/mol, XLogP of 6.32, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-(1-chloroheptyl)-2,5-dimethylbenzene is sourced from PubChem (CID 114753647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).