C17H27Cl — CID 114753498
3-(1-chloroheptyl)-1,2,4,5-tetramethylbenzene (PubChem CID 114753498) has the molecular formula C17H27Cl and a molecular weight of 266.86 g/mol. Its IUPAC name is 3-(1-chloroheptyl)-1,2,4,5-tetramethylbenzene.
| Compound Name | 3-(1-chloroheptyl)-1,2,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 114753498 |
| Molecular Formula | C17H27Cl |
| Molecular Weight | 266.86 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 3-(1-chloroheptyl)-1,2,4,5-tetramethylbenzene |
| SMILES | CCCCCCC(Cl)c1c(C)c(C)cc(C)c1C |
| InChI | InChI=1S/C17H27Cl/c1-6-7-8-9-10-16(18)17-14(4)12(2)11-13(3)15(17)5/h11,16H,6-10H2,1-5H3 |
| InChIKey | DUBLLWHGTUPFDB-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.86 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|