C13H19ClO — CID 154224205
3-(1-chloropentyl)-2,4-dimethylphenol (PubChem CID 154224205) has the molecular formula C13H19ClO and a molecular weight of 226.75 g/mol. Its IUPAC name is 3-(1-chloropentyl)-2,4-dimethylphenol.
| Compound Name | 3-(1-chloropentyl)-2,4-dimethylphenol |
|---|---|
| PubChem CID | 154224205 |
| Molecular Formula | C13H19ClO |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 3-(1-chloropentyl)-2,4-dimethylphenol |
| SMILES | CCCCC(Cl)c1c(C)ccc(O)c1C |
| InChI | InChI=1S/C13H19ClO/c1-4-5-6-11(14)13-9(2)7-8-12(15)10(13)3/h7-8,11,15H,4-6H2,1-3H3 |
| InChIKey | JCAIROSTSSQZIV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|