C11H18O2 — CID 162191958
ethanol;2,3,4-trimethylphenol (PubChem CID 162191958) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is ethanol;2,3,4-trimethylphenol.
| Compound Name | ethanol;2,3,4-trimethylphenol |
|---|---|
| PubChem CID | 162191958 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | ethanol;2,3,4-trimethylphenol |
| SMILES | CCO.Cc1ccc(O)c(C)c1C |
| InChI | InChI=1S/C9H12O.C2H6O/c1-6-4-5-9(10)8(3)7(6)2;1-2-3/h4-5,10H,1-3H3;3H,2H2,1H3 |
| InChIKey | ZQKORLXOZKQCEM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |