C10H14Ru — CID 158325243
ruthenium;1,2,3,4-tetramethylbenzene (PubChem CID 158325243) has the molecular formula C10H14Ru and a molecular weight of 235.29 g/mol. Its IUPAC name is ruthenium;1,2,3,4-tetramethylbenzene.
| Compound Name | ruthenium;1,2,3,4-tetramethylbenzene |
|---|---|
| PubChem CID | 158325243 |
| Molecular Formula | C10H14Ru |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | ruthenium;1,2,3,4-tetramethylbenzene |
| SMILES | Cc1ccc(C)c(C)c1C.[Ru] |
| InChI | InChI=1S/C10H14.Ru/c1-7-5-6-8(2)10(4)9(7)3;/h5-6H,1-4H3; |
| InChIKey | GPIBWXYJPSAEIA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |