C9H12LiN — CID 141493779
lithium (2,3,4-trimethylphenyl)azanide (PubChem CID 141493779) has the molecular formula C9H12LiN and a molecular weight of 141.14 g/mol. Its IUPAC name is lithium (2,3,4-trimethylphenyl)azanide.
| Compound Name | lithium (2,3,4-trimethylphenyl)azanide |
|---|---|
| PubChem CID | 141493779 |
| Molecular Formula | C9H12LiN |
| Molecular Weight | 141.14 g/mol |
| Exact Mass | 141.11 |
| IUPAC Name | lithium (2,3,4-trimethylphenyl)azanide |
| SMILES | Cc1ccc([NH-])c(C)c1C.[Li+] |
| InChI | InChI=1S/C9H12N.Li/c1-6-4-5-9(10)8(3)7(6)2;/h4-5,10H,1-3H3;/q-1;+1 |
| InChIKey | FVSOSZCTJWIVLT-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.14 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |