C18H22Se2 — CID 155677375
1,2,3-trimethyl-4-[(2,3,4-trimethylphenyl)diselanyl]benzene (PubChem CID 155677375) has the molecular formula C18H22Se2 and a molecular weight of 396.29 g/mol. Its IUPAC name is 1,2,3-trimethyl-4-[(2,3,4-trimethylphenyl)diselanyl]benzene.
| Compound Name | 1,2,3-trimethyl-4-[(2,3,4-trimethylphenyl)diselanyl]benzene |
|---|---|
| PubChem CID | 155677375 |
| Molecular Formula | C18H22Se2 |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | 1,2,3-trimethyl-4-[(2,3,4-trimethylphenyl)diselanyl]benzene |
| SMILES | Cc1ccc([Se][Se]c2ccc(C)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C18H22Se2/c1-11-7-9-17(15(5)13(11)3)19-20-18-10-8-12(2)14(4)16(18)6/h7-10H,1-6H3 |
| InChIKey | ZSXZACUWGQHBBX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|