C32H40 — CID 173333088
1,2,3,4-tetramethylbenzene;toluene;1,2-xylene (PubChem CID 173333088) has the molecular formula C32H40 and a molecular weight of 424.67 g/mol. Its IUPAC name is 1,2,3,4-tetramethylbenzene;toluene;1,2-xylene.
| Compound Name | 1,2,3,4-tetramethylbenzene;toluene;1,2-xylene |
|---|---|
| PubChem CID | 173333088 |
| Molecular Formula | C32H40 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.31 |
| IUPAC Name | 1,2,3,4-tetramethylbenzene;toluene;1,2-xylene |
| SMILES | Cc1ccc(C)c(C)c1C.Cc1ccccc1.Cc1ccccc1.Cc1ccccc1C |
| InChI | InChI=1S/C10H14.C8H10.2C7H8/c1-7-5-6-8(2)10(4)9(7)3;1-7-5-3-4-6-8(7)2;2*1-7-5-3-2-4-6-7/h5-6H,1-4H3;3-6H,1-2H3;2*2-6H,1H3 |
| InChIKey | NMERYTDZUOHUNK-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |