About propan-2-ol;toluene;1,2-xylene
propan-2-ol;toluene;1,2-xylene (PubChem CID 175542650) has the molecular formula C18H26O
and a molecular weight of 258.40 g/mol. Its IUPAC name is propan-2-ol;toluene;1,2-xylene.
Molecular Properties
| Compound Name | propan-2-ol;toluene;1,2-xylene |
| PubChem CID | 175542650 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | propan-2-ol;toluene;1,2-xylene |
| SMILES | CC(C)O.Cc1ccccc1.Cc1ccccc1C |
| InChI | InChI=1S/C8H10.C7H8.C3H8O/c1-7-5-3-4-6-8(7)2;1-7-5-3-2-4-6-7;1-3(2)4/h3-6H,1-2H3;2-6H,1H3;3-4H,1-2H3 |
| InChIKey | YSLAWTWBTFPBJE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propan-2-ol;toluene;1,2-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ol;toluene;1,2-xylene?
The IUPAC name of propan-2-ol;toluene;1,2-xylene (CID 175542650) is propan-2-ol;toluene;1,2-xylene.
What is the SMILES notation for propan-2-ol;toluene;1,2-xylene?
The canonical SMILES for propan-2-ol;toluene;1,2-xylene is CC(C)O.Cc1ccccc1.Cc1ccccc1C.
What is the InChIKey of propan-2-ol;toluene;1,2-xylene?
The InChIKey is YSLAWTWBTFPBJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.C7H8.C3H8O/c1-7-5-3-4-6-8(7)2;1-7-5-3-2-4-6-7;1-3(2)4/h3-6H,1-2H3;2-6H,1H3;3-4H,1-2H3.
What are the key properties of propan-2-ol;toluene;1,2-xylene?
propan-2-ol;toluene;1,2-xylene has a molecular weight of 258.40 g/mol, XLogP of 4.69, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ol;toluene;1,2-xylene is sourced from PubChem (CID 175542650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).