About dimethyl-(2,3,4-trimethylphenyl)phosphane
dimethyl-(2,3,4-trimethylphenyl)phosphane (PubChem CID 90111171) has the molecular formula C11H17P
and a molecular weight of 180.23 g/mol. Its IUPAC name is dimethyl-(2,3,4-trimethylphenyl)phosphane.
Molecular Properties
| Compound Name | dimethyl-(2,3,4-trimethylphenyl)phosphane |
| PubChem CID | 90111171 |
| Molecular Formula | C11H17P |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | dimethyl-(2,3,4-trimethylphenyl)phosphane |
| SMILES | Cc1ccc(P(C)C)c(C)c1C |
| InChI | InChI=1S/C11H17P/c1-8-6-7-11(12(4)5)10(3)9(8)2/h6-7H,1-5H3 |
| InChIKey | OKKGGYAAKSLTHV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-(2,3,4-trimethylphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-(2,3,4-trimethylphenyl)phosphane?
The IUPAC name of dimethyl-(2,3,4-trimethylphenyl)phosphane (CID 90111171) is dimethyl-(2,3,4-trimethylphenyl)phosphane.
What is the SMILES notation for dimethyl-(2,3,4-trimethylphenyl)phosphane?
The canonical SMILES for dimethyl-(2,3,4-trimethylphenyl)phosphane is Cc1ccc(P(C)C)c(C)c1C.
What is the InChIKey of dimethyl-(2,3,4-trimethylphenyl)phosphane?
The InChIKey is OKKGGYAAKSLTHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17P/c1-8-6-7-11(12(4)5)10(3)9(8)2/h6-7H,1-5H3.
What are the key properties of dimethyl-(2,3,4-trimethylphenyl)phosphane?
dimethyl-(2,3,4-trimethylphenyl)phosphane has a molecular weight of 180.23 g/mol, XLogP of 2.98, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-(2,3,4-trimethylphenyl)phosphane is sourced from PubChem (CID 90111171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).