C11H17P — CID 90111171
dimethyl-(2,3,4-trimethylphenyl)phosphane (PubChem CID 90111171) has the molecular formula C11H17P and a molecular weight of 180.23 g/mol. Its IUPAC name is dimethyl-(2,3,4-trimethylphenyl)phosphane.
| Compound Name | dimethyl-(2,3,4-trimethylphenyl)phosphane |
|---|---|
| PubChem CID | 90111171 |
| Molecular Formula | C11H17P |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | dimethyl-(2,3,4-trimethylphenyl)phosphane |
| SMILES | Cc1ccc(P(C)C)c(C)c1C |
| InChI | InChI=1S/C11H17P/c1-8-6-7-11(12(4)5)10(3)9(8)2/h6-7H,1-5H3 |
| InChIKey | OKKGGYAAKSLTHV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|