C18H31P — CID 90109576
hexyl-propyl-(2,3,4-trimethylphenyl)phosphane (PubChem CID 90109576) has the molecular formula C18H31P and a molecular weight of 278.42 g/mol. Its IUPAC name is hexyl-propyl-(2,3,4-trimethylphenyl)phosphane.
| Compound Name | hexyl-propyl-(2,3,4-trimethylphenyl)phosphane |
|---|---|
| PubChem CID | 90109576 |
| Molecular Formula | C18H31P |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | hexyl-propyl-(2,3,4-trimethylphenyl)phosphane |
| SMILES | CCCCCCP(CCC)c1ccc(C)c(C)c1C |
| InChI | InChI=1S/C18H31P/c1-6-8-9-10-14-19(13-7-2)18-12-11-15(3)16(4)17(18)5/h11-12H,6-10,13-14H2,1-5H3 |
| InChIKey | BPBOGSFUNZITJM-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|