C18H23OP — CID 175402042
bis(2,3,4-trimethylphenyl)phosphinous acid (PubChem CID 175402042) has the molecular formula C18H23OP and a molecular weight of 286.36 g/mol. Its IUPAC name is bis(2,3,4-trimethylphenyl)phosphinous acid.
| Compound Name | bis(2,3,4-trimethylphenyl)phosphinous acid |
|---|---|
| PubChem CID | 175402042 |
| Molecular Formula | C18H23OP |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | bis(2,3,4-trimethylphenyl)phosphinous acid |
| SMILES | Cc1ccc(P(O)c2ccc(C)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C18H23OP/c1-11-7-9-17(15(5)13(11)3)20(19)18-10-8-12(2)14(4)16(18)6/h7-10,19H,1-6H3 |
| InChIKey | VGQQUGIBHJDOFN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|