bis(2,3,4-trimethylphenyl)phosphinous acid

C18H23OP — CID 175402042

IUPACbis(2,3,4-trimethylphenyl)phosphinous acid
SMILESCc1ccc(P(O)c2ccc(C)c(C)c2C)c(C)c1C
InChIInChI=1S/C18H23OP/c1-11-7-9-17(15(5)13(11)3)20(19)18-10-8-12(2)14(4)16(18)6/h7-10,19H,1-6H3
InChIKeyVGQQUGIBHJDOFN-UHFFFAOYSA-N
MW286.36 g/mol
LogP3.88
Rot. Bonds2

About bis(2,3,4-trimethylphenyl)phosphinous acid

bis(2,3,4-trimethylphenyl)phosphinous acid (PubChem CID 175402042) has the molecular formula C18H23OP and a molecular weight of 286.36 g/mol. Its IUPAC name is bis(2,3,4-trimethylphenyl)phosphinous acid.

Molecular Properties

Compound Namebis(2,3,4-trimethylphenyl)phosphinous acid
PubChem CID175402042
Molecular FormulaC18H23OP
Molecular Weight286.36 g/mol
Exact Mass286.15
IUPAC Namebis(2,3,4-trimethylphenyl)phosphinous acid
SMILESCc1ccc(P(O)c2ccc(C)c(C)c2C)c(C)c1C
InChIInChI=1S/C18H23OP/c1-11-7-9-17(15(5)13(11)3)20(19)18-10-8-12(2)14(4)16(18)6/h7-10,19H,1-6H3
InChIKeyVGQQUGIBHJDOFN-UHFFFAOYSA-N
XLogP3.88
TPSA20.23 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.36
LogP ≤ 53.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze bis(2,3,4-trimethylphenyl)phosphinous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bis(2,3,4-trimethylphenyl)phosphinous acid?
The IUPAC name of bis(2,3,4-trimethylphenyl)phosphinous acid (CID 175402042) is bis(2,3,4-trimethylphenyl)phosphinous acid.
What is the SMILES notation for bis(2,3,4-trimethylphenyl)phosphinous acid?
The canonical SMILES for bis(2,3,4-trimethylphenyl)phosphinous acid is Cc1ccc(P(O)c2ccc(C)c(C)c2C)c(C)c1C.
What is the InChIKey of bis(2,3,4-trimethylphenyl)phosphinous acid?
The InChIKey is VGQQUGIBHJDOFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23OP/c1-11-7-9-17(15(5)13(11)3)20(19)18-10-8-12(2)14(4)16(18)6/h7-10,19H,1-6H3.
What are the key properties of bis(2,3,4-trimethylphenyl)phosphinous acid?
bis(2,3,4-trimethylphenyl)phosphinous acid has a molecular weight of 286.36 g/mol, XLogP of 3.88, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,3,4-trimethylphenyl)phosphinous acid is sourced from PubChem (CID 175402042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).