C46H52CrP2 — CID 157416744
chromium(2+);bis(cyclopenta-1,3-dien-1-yl-bis(2,3,4-trimethylphenyl)phosphane) (PubChem CID 157416744) has the molecular formula C46H52CrP2 and a molecular weight of 718.87 g/mol. Its IUPAC name is chromium(2+);bis(cyclopenta-1,3-dien-1-yl-bis(2,3,4-trimethylphenyl)phosphane).
| Compound Name | chromium(2+);bis(cyclopenta-1,3-dien-1-yl-bis(2,3,4-trimethylphenyl)phosphane) |
|---|---|
| PubChem CID | 157416744 |
| Molecular Formula | C46H52CrP2 |
| Molecular Weight | 718.87 g/mol |
| Exact Mass | 718.29 |
| IUPAC Name | chromium(2+);bis(cyclopenta-1,3-dien-1-yl-bis(2,3,4-trimethylphenyl)phosphane) |
| SMILES | Cc1ccc(P(c2ccc[cH-]2)c2ccc(C)c(C)c2C)c(C)c1C.Cc1ccc(P(c2ccc[cH-]2)c2ccc(C)c(C)c2C)c(C)c1C.[Cr+2] |
| InChI | InChI=1S/2C23H26P.Cr/c2*1-15-11-13-22(19(5)17(15)3)24(21-9-7-8-10-21)23-14-12-16(2)18(4)20(23)6;/h2*7-14H,1-6H3;/q2*-1;+2 |
| InChIKey | BOXYNJVOCPUXRI-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.87 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|