C12H14Cr — CID 160665189
chromium(2+);bis(1-methylcyclopenta-1,3-diene) (PubChem CID 160665189) has the molecular formula C12H14Cr and a molecular weight of 210.24 g/mol. Its IUPAC name is chromium(2+);bis(1-methylcyclopenta-1,3-diene).
| Compound Name | chromium(2+);bis(1-methylcyclopenta-1,3-diene) |
|---|---|
| PubChem CID | 160665189 |
| Molecular Formula | C12H14Cr |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | chromium(2+);bis(1-methylcyclopenta-1,3-diene) |
| SMILES | Cc1ccc[cH-]1.Cc1ccc[cH-]1.[Cr+2] |
| InChI | InChI=1S/2C6H7.Cr/c2*1-6-4-2-3-5-6;/h2*2-5H,1H3;/q2*-1;+2 |
| InChIKey | RMEVYMVMJMKSHB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|