C10H8I2Ru — CID 158276340
bis(1-iodocyclopenta-1,3-diene);ruthenium(2+) (PubChem CID 158276340) has the molecular formula C10H8I2Ru and a molecular weight of 483.05 g/mol. Its IUPAC name is bis(1-iodocyclopenta-1,3-diene);ruthenium(2+).
| Compound Name | bis(1-iodocyclopenta-1,3-diene);ruthenium(2+) |
|---|---|
| PubChem CID | 158276340 |
| Molecular Formula | C10H8I2Ru |
| Molecular Weight | 483.05 g/mol |
| Exact Mass | 483.78 |
| IUPAC Name | bis(1-iodocyclopenta-1,3-diene);ruthenium(2+) |
| SMILES | Ic1ccc[cH-]1.Ic1ccc[cH-]1.[Ru+2] |
| InChI | InChI=1S/2C5H4I.Ru/c2*6-5-3-1-2-4-5;/h2*1-4H;/q2*-1;+2 |
| InChIKey | GJQOXDHUUXVKLK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.05 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|