C10H9- — CID 135031993
1-cyclopenta-2,4-dien-1-ylcyclopenta-1,3-diene (PubChem CID 135031993) has the molecular formula C10H9- and a molecular weight of 129.18 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-ylcyclopenta-1,3-diene.
| Compound Name | 1-cyclopenta-2,4-dien-1-ylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 135031993 |
| Molecular Formula | C10H9- |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.07 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-ylcyclopenta-1,3-diene |
| SMILES | C1=CC(c2ccc[cH-]2)C=C1 |
| InChI | InChI=1S/C10H9/c1-2-6-9(5-1)10-7-3-4-8-10/h1-9H/q-1 |
| InChIKey | RMFDFFFJJKISEP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|