C12H15Si- — CID 11985517
cyclopenta-1,3-dien-1-yl-cyclopenta-2,4-dien-1-yl-dimethylsilane (PubChem CID 11985517) has the molecular formula C12H15Si- and a molecular weight of 187.34 g/mol. Its IUPAC name is cyclopenta-1,3-dien-1-yl-cyclopenta-2,4-dien-1-yl-dimethylsilane.
| Compound Name | cyclopenta-1,3-dien-1-yl-cyclopenta-2,4-dien-1-yl-dimethylsilane |
|---|---|
| PubChem CID | 11985517 |
| Molecular Formula | C12H15Si- |
| Molecular Weight | 187.34 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | cyclopenta-1,3-dien-1-yl-cyclopenta-2,4-dien-1-yl-dimethylsilane |
| SMILES | C[Si](C)(c1ccc[cH-]1)C1C=CC=C1 |
| InChI | InChI=1S/C12H15Si/c1-13(2,11-7-3-4-8-11)12-9-5-6-10-12/h3-11H,1-2H3/q-1 |
| InChIKey | WTBBLOGNYHACDD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|