C18H18SiTi — CID 174994654
cyclopenta-2,4-dien-1-yl-methyl-diphenylsilane;titanium (PubChem CID 174994654) has the molecular formula C18H18SiTi and a molecular weight of 310.30 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-yl-methyl-diphenylsilane;titanium.
| Compound Name | cyclopenta-2,4-dien-1-yl-methyl-diphenylsilane;titanium |
|---|---|
| PubChem CID | 174994654 |
| Molecular Formula | C18H18SiTi |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | cyclopenta-2,4-dien-1-yl-methyl-diphenylsilane;titanium |
| SMILES | C[Si](c1ccccc1)(c1ccccc1)C1C=CC=C1.[Ti] |
| InChI | InChI=1S/C18H18Si.Ti/c1-19(18-14-8-9-15-18,16-10-4-2-5-11-16)17-12-6-3-7-13-17;/h2-15,18H,1H3; |
| InChIKey | XDJDGWVOXJTIQQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|