C13H26Si2 — CID 161005748
tetramethylsilane;trimethyl(phenyl)silane (PubChem CID 161005748) has the molecular formula C13H26Si2 and a molecular weight of 238.52 g/mol. Its IUPAC name is tetramethylsilane;trimethyl(phenyl)silane.
| Compound Name | tetramethylsilane;trimethyl(phenyl)silane |
|---|---|
| PubChem CID | 161005748 |
| Molecular Formula | C13H26Si2 |
| Molecular Weight | 238.52 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | tetramethylsilane;trimethyl(phenyl)silane |
| SMILES | C[Si](C)(C)C.C[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C9H14Si.C4H12Si/c1-10(2,3)9-7-5-4-6-8-9;1-5(2,3)4/h4-8H,1-3H3;1-4H3 |
| InChIKey | TWMAZJSDXRYZGC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|