C35H30Si — CID 157160990
trimethyl-[4-[4-(10-phenylanthracen-9-yl)phenyl]phenyl]silane (PubChem CID 157160990) has the molecular formula C35H30Si and a molecular weight of 478.71 g/mol. Its IUPAC name is trimethyl-[4-[4-(10-phenylanthracen-9-yl)phenyl]phenyl]silane.
| Compound Name | trimethyl-[4-[4-(10-phenylanthracen-9-yl)phenyl]phenyl]silane |
|---|---|
| PubChem CID | 157160990 |
| Molecular Formula | C35H30Si |
| Molecular Weight | 478.71 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | trimethyl-[4-[4-(10-phenylanthracen-9-yl)phenyl]phenyl]silane |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc(-c3c4ccccc4c(-c4ccccc4)c4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C35H30Si/c1-36(2,3)29-23-21-26(22-24-29)25-17-19-28(20-18-25)35-32-15-9-7-13-30(32)34(27-11-5-4-6-12-27)31-14-8-10-16-33(31)35/h4-24H,1-3H3 |
| InChIKey | VLZNUNGXRGZSMO-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.71 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|