C75H66Si3 — CID 58722457
[4-[10-[3,5-bis[10-(4-trimethylsilylphenyl)anthracen-9-yl]phenyl]anthracen-9-yl]phenyl]-trimethylsilane (PubChem CID 58722457) has the molecular formula C75H66Si3 and a molecular weight of 1051.61 g/mol. Its IUPAC name is [4-[10-[3,5-bis[10-(4-trimethylsilylphenyl)anthracen-9-yl]phenyl]anthracen-9-yl]phenyl]-trimethylsilane.
| Compound Name | [4-[10-[3,5-bis[10-(4-trimethylsilylphenyl)anthracen-9-yl]phenyl]anthracen-9-yl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 58722457 |
| Molecular Formula | C75H66Si3 |
| Molecular Weight | 1051.61 g/mol |
| Exact Mass | 1050.45 |
| IUPAC Name | [4-[10-[3,5-bis[10-(4-trimethylsilylphenyl)anthracen-9-yl]phenyl]anthracen-9-yl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(-c2c3ccccc3c(-c3cc(-c4c5ccccc5c(-c5ccc([Si](C)(C)C)cc5)c5ccccc45)cc(-c4c5ccccc5c(-c5ccc([Si](C)(C)C)cc5)c5ccccc45)c3)c3ccccc23)cc1 |
| InChI | InChI=1S/C75H66Si3/c1-76(2,3)55-40-34-49(35-41-55)70-58-22-10-16-28-64(58)73(65-29-17-11-23-59(65)70)52-46-53(74-66-30-18-12-24-60(66)71(61-25-13-19-31-67(61)74)50-36-42-56(43-37-50)77(4,5)6)48-54(47-52)75-68-32-20-14-26-62(68)72(63-27-15-21-33-69(63)75)51-38-44-57(45-39-51)78(7,8)9/h10-48H,1-9H3 |
| InChIKey | YETVDZLLJYNTAA-UHFFFAOYSA-N |
| XLogP | 20.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1051.61 |
| LogP ≤ 5 | 20.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|