C39H32OSi — CID 171056465
[4-[4-[3-(4-dibenzofuran-2-ylphenyl)phenyl]phenyl]phenyl]-trimethylsilane (PubChem CID 171056465) has the molecular formula C39H32OSi and a molecular weight of 544.77 g/mol. Its IUPAC name is [4-[4-[3-(4-dibenzofuran-2-ylphenyl)phenyl]phenyl]phenyl]-trimethylsilane.
| Compound Name | [4-[4-[3-(4-dibenzofuran-2-ylphenyl)phenyl]phenyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 171056465 |
| Molecular Formula | C39H32OSi |
| Molecular Weight | 544.77 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | [4-[4-[3-(4-dibenzofuran-2-ylphenyl)phenyl]phenyl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc(-c3cccc(-c4ccc(-c5ccc6oc7ccccc7c6c5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C39H32OSi/c1-41(2,3)35-22-19-28(20-23-35)27-11-13-29(14-12-27)32-7-6-8-33(25-32)30-15-17-31(18-16-30)34-21-24-39-37(26-34)36-9-4-5-10-38(36)40-39/h4-26H,1-3H3 |
| InChIKey | MUDDXLFKOAZOPD-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.77 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|