C52H39N3OSi — CID 176645273
trimethyl-[4-[3-[3-[3-(4-naphtho[2,3-b][1]benzofuran-2-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]phenyl]silane (PubChem CID 176645273) has the molecular formula C52H39N3OSi and a molecular weight of 749.99 g/mol. Its IUPAC name is trimethyl-[4-[3-[3-[3-(4-naphtho[2,3-b][1]benzofuran-2-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]phenyl]silane.
| Compound Name | trimethyl-[4-[3-[3-[3-(4-naphtho[2,3-b][1]benzofuran-2-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]phenyl]silane |
|---|---|
| PubChem CID | 176645273 |
| Molecular Formula | C52H39N3OSi |
| Molecular Weight | 749.99 g/mol |
| Exact Mass | 749.29 |
| IUPAC Name | trimethyl-[4-[3-[3-[3-(4-naphtho[2,3-b][1]benzofuran-2-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]phenyl]silane |
| SMILES | C[Si](C)(C)c1ccc(-c2cccc(-c3cccc(-c4cccc(-c5nc(-c6ccccc6)nc(-c6ccc7oc8cc9ccccc9cc8c7c6)n5)c4)c3)c2)cc1 |
| InChI | InChI=1S/C52H39N3OSi/c1-57(2,3)45-25-22-34(23-26-45)36-16-9-17-37(28-36)38-18-10-19-39(29-38)40-20-11-21-43(30-40)51-53-50(35-12-5-4-6-13-35)54-52(55-51)44-24-27-48-46(32-44)47-31-41-14-7-8-15-42(41)33-49(47)56-48/h4-33H,1-3H3 |
| InChIKey | KUBJEKCBFSJCBH-UHFFFAOYSA-N |
| XLogP | 13.47 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.99 |
| LogP ≤ 5 | 13.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|