C60H47N3Si — CID 176645442
trimethyl-[4-[4-(4-phenylphenyl)-6-[3-[3-[3-[3-(3-phenylphenyl)phenyl]phenyl]phenyl]phenyl]-1,3,5-triazin-2-yl]phenyl]silane (PubChem CID 176645442) has the molecular formula C60H47N3Si and a molecular weight of 838.14 g/mol. Its IUPAC name is trimethyl-[4-[4-(4-phenylphenyl)-6-[3-[3-[3-[3-(3-phenylphenyl)phenyl]phenyl]phenyl]phenyl]-1,3,5-triazin-2-yl]phenyl]silane.
| Compound Name | trimethyl-[4-[4-(4-phenylphenyl)-6-[3-[3-[3-[3-(3-phenylphenyl)phenyl]phenyl]phenyl]phenyl]-1,3,5-triazin-2-yl]phenyl]silane |
|---|---|
| PubChem CID | 176645442 |
| Molecular Formula | C60H47N3Si |
| Molecular Weight | 838.14 g/mol |
| Exact Mass | 837.35 |
| IUPAC Name | trimethyl-[4-[4-(4-phenylphenyl)-6-[3-[3-[3-[3-(3-phenylphenyl)phenyl]phenyl]phenyl]phenyl]-1,3,5-triazin-2-yl]phenyl]silane |
| SMILES | C[Si](C)(C)c1ccc(-c2nc(-c3ccc(-c4ccccc4)cc3)nc(-c3cccc(-c4cccc(-c5cccc(-c6cccc(-c7cccc(-c8ccccc8)c7)c6)c5)c4)c3)n2)cc1 |
| InChI | InChI=1S/C60H47N3Si/c1-64(2,3)57-35-33-46(34-36-57)59-61-58(45-31-29-44(30-32-45)42-15-6-4-7-16-42)62-60(63-59)56-28-14-27-55(41-56)54-26-13-25-53(40-54)52-24-12-23-51(39-52)50-22-11-21-49(38-50)48-20-10-19-47(37-48)43-17-8-5-9-18-43/h4-41H,1-3H3 |
| InChIKey | YFRHSGLMFHRZOW-UHFFFAOYSA-N |
| XLogP | 15.42 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.14 |
| LogP ≤ 5 | 15.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|