C48H39N3Si — CID 176645210
trimethyl-[4-[3-[3-[4-(2-phenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]silane (PubChem CID 176645210) has the molecular formula C48H39N3Si and a molecular weight of 685.95 g/mol. Its IUPAC name is trimethyl-[4-[3-[3-[4-(2-phenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]silane.
| Compound Name | trimethyl-[4-[3-[3-[4-(2-phenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]silane |
|---|---|
| PubChem CID | 176645210 |
| Molecular Formula | C48H39N3Si |
| Molecular Weight | 685.95 g/mol |
| Exact Mass | 685.29 |
| IUPAC Name | trimethyl-[4-[3-[3-[4-(2-phenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]silane |
| SMILES | C[Si](C)(C)c1ccc(-c2cccc(-c3cccc(-c4nc(-c5ccc(-c6ccccc6)cc5)nc(-c5ccccc5-c5ccccc5)n4)c3)c2)cc1 |
| InChI | InChI=1S/C48H39N3Si/c1-52(2,3)43-30-28-36(29-31-43)39-18-12-19-40(32-39)41-20-13-21-42(33-41)47-49-46(38-26-24-35(25-27-38)34-14-6-4-7-15-34)50-48(51-47)45-23-11-10-22-44(45)37-16-8-5-9-17-37/h4-33H,1-3H3 |
| InChIKey | ITAXMUHTXBPHAF-UHFFFAOYSA-N |
| XLogP | 12.09 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.95 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|