C39H39N3Si2 — CID 176645249
[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(4-trimethylsilylphenyl)phenyl]phenyl]-trimethylsilane (PubChem CID 176645249) has the molecular formula C39H39N3Si2 and a molecular weight of 605.93 g/mol. Its IUPAC name is [4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(4-trimethylsilylphenyl)phenyl]phenyl]-trimethylsilane.
| Compound Name | [4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(4-trimethylsilylphenyl)phenyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 176645249 |
| Molecular Formula | C39H39N3Si2 |
| Molecular Weight | 605.93 g/mol |
| Exact Mass | 605.27 |
| IUPAC Name | [4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(4-trimethylsilylphenyl)phenyl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(-c2cc(-c3ccc([Si](C)(C)C)cc3)cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)cc1 |
| InChI | InChI=1S/C39H39N3Si2/c1-43(2,3)35-21-17-28(18-22-35)32-25-33(29-19-23-36(24-20-29)44(4,5)6)27-34(26-32)39-41-37(30-13-9-7-10-14-30)40-38(42-39)31-15-11-8-12-16-31/h7-27H,1-6H3 |
| InChIKey | VSDWWWKFBFTFCX-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.93 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|