C54H43N3Si — CID 176645314
[3-[3-[4,6-bis[3-(3-phenylphenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]phenyl]-trimethylsilane (PubChem CID 176645314) has the molecular formula C54H43N3Si and a molecular weight of 762.05 g/mol. Its IUPAC name is [3-[3-[4,6-bis[3-(3-phenylphenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]phenyl]-trimethylsilane.
| Compound Name | [3-[3-[4,6-bis[3-(3-phenylphenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 176645314 |
| Molecular Formula | C54H43N3Si |
| Molecular Weight | 762.05 g/mol |
| Exact Mass | 761.32 |
| IUPAC Name | [3-[3-[4,6-bis[3-(3-phenylphenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1cccc(-c2cccc(-c3nc(-c4cccc(-c5cccc(-c6ccccc6)c5)c4)nc(-c4cccc(-c5cccc(-c6ccccc6)c5)c4)n3)c2)c1 |
| InChI | InChI=1S/C54H43N3Si/c1-58(2,3)51-31-15-27-47(37-51)46-26-14-30-50(36-46)54-56-52(48-28-12-24-44(34-48)42-22-10-20-40(32-42)38-16-6-4-7-17-38)55-53(57-54)49-29-13-25-45(35-49)43-23-11-21-41(33-43)39-18-8-5-9-19-39/h4-37H,1-3H3 |
| InChIKey | XHQIFTAQKQWBOQ-UHFFFAOYSA-N |
| XLogP | 13.75 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.05 |
| LogP ≤ 5 | 13.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|