C25H26Si2 — CID 122207041
cyclopenta-2,4-dien-1-yl-dimethyl-triphenylsilylsilane (PubChem CID 122207041) has the molecular formula C25H26Si2 and a molecular weight of 382.66 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-yl-dimethyl-triphenylsilylsilane.
| Compound Name | cyclopenta-2,4-dien-1-yl-dimethyl-triphenylsilylsilane |
|---|---|
| PubChem CID | 122207041 |
| Molecular Formula | C25H26Si2 |
| Molecular Weight | 382.66 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | cyclopenta-2,4-dien-1-yl-dimethyl-triphenylsilylsilane |
| SMILES | C[Si](C)(C1C=CC=C1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26Si2/c1-26(2,22-14-12-13-15-22)27(23-16-6-3-7-17-23,24-18-8-4-9-19-24)25-20-10-5-11-21-25/h3-22H,1-2H3 |
| InChIKey | UVNKPASZYLCESS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.66 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|