C18H24Si2 — CID 12983984
cyclopenta-2,4-dien-1-yl-[1H-inden-1-yl(dimethyl)silyl]-dimethylsilane (PubChem CID 12983984) has the molecular formula C18H24Si2 and a molecular weight of 296.56 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-yl-[1H-inden-1-yl(dimethyl)silyl]-dimethylsilane.
| Compound Name | cyclopenta-2,4-dien-1-yl-[1H-inden-1-yl(dimethyl)silyl]-dimethylsilane |
|---|---|
| PubChem CID | 12983984 |
| Molecular Formula | C18H24Si2 |
| Molecular Weight | 296.56 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | cyclopenta-2,4-dien-1-yl-[1H-inden-1-yl(dimethyl)silyl]-dimethylsilane |
| SMILES | C[Si](C)(C1C=CC=C1)[Si](C)(C)C1C=Cc2ccccc21 |
| InChI | InChI=1S/C18H24Si2/c1-19(2,16-10-6-7-11-16)20(3,4)18-14-13-15-9-5-8-12-17(15)18/h5-14,16,18H,1-4H3 |
| InChIKey | STQGRZVRBOFYIB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.56 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|