C27H27NSi — CID 142712261
4-[bis(1H-inden-1-yl)-methylsilyl]-N,N-dimethylaniline (PubChem CID 142712261) has the molecular formula C27H27NSi and a molecular weight of 393.61 g/mol. Its IUPAC name is 4-[bis(1H-inden-1-yl)-methylsilyl]-N,N-dimethylaniline.
| Compound Name | 4-[bis(1H-inden-1-yl)-methylsilyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 142712261 |
| Molecular Formula | C27H27NSi |
| Molecular Weight | 393.61 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 4-[bis(1H-inden-1-yl)-methylsilyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc([Si](C)(C2C=Cc3ccccc32)C2C=Cc3ccccc32)cc1 |
| InChI | InChI=1S/C27H27NSi/c1-28(2)22-14-16-23(17-15-22)29(3,26-18-12-20-8-4-6-10-24(20)26)27-19-13-21-9-5-7-11-25(21)27/h4-19,26-27H,1-3H3 |
| InChIKey | FEEILQYVUKNORM-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.61 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|