About (1R,2R)-2-[4-(dimethylamino)-2-methylphenyl]-1,2-dihydronaphthalen-1-ol
(1R,2R)-2-[4-(dimethylamino)-2-methylphenyl]-1,2-dihydronaphthalen-1-ol (PubChem CID 134960838) has the molecular formula C19H21NO
and a molecular weight of 279.38 g/mol. Its IUPAC name is (1R,2R)-2-[4-(dimethylamino)-2-methylphenyl]-1,2-dihydronaphthalen-1-ol.
Molecular Properties
| Compound Name | (1R,2R)-2-[4-(dimethylamino)-2-methylphenyl]-1,2-dihydronaphthalen-1-ol |
| PubChem CID | 134960838 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (1R,2R)-2-[4-(dimethylamino)-2-methylphenyl]-1,2-dihydronaphthalen-1-ol |
| SMILES | Cc1cc(N(C)C)ccc1[C@H]1C=Cc2ccccc2[C@@H]1O |
| InChI | InChI=1S/C19H21NO/c1-13-12-15(20(2)3)9-11-16(13)18-10-8-14-6-4-5-7-17(14)19(18)21/h4-12,18-19,21H,1-3H3/t18-,19+/m1/s1 |
| InChIKey | JNTHZCJOMILLMF-MOPGFXCFSA-N |
| XLogP | 3.91 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze (1R,2R)-2-[4-(dimethylamino)-2-methylphenyl]-1,2-dihydronaphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2R)-2-[4-(dimethylamino)-2-methylphenyl]-1,2-dihydronaphthalen-1-ol?
The IUPAC name of (1R,2R)-2-[4-(dimethylamino)-2-methylphenyl]-1,2-dihydronaphthalen-1-ol (CID 134960838) is (1R,2R)-2-[4-(dimethylamino)-2-methylphenyl]-1,2-dihydronaphthalen-1-ol.
What is the SMILES notation for (1R,2R)-2-[4-(dimethylamino)-2-methylphenyl]-1,2-dihydronaphthalen-1-ol?
The canonical SMILES for (1R,2R)-2-[4-(dimethylamino)-2-methylphenyl]-1,2-dihydronaphthalen-1-ol is Cc1cc(N(C)C)ccc1[C@H]1C=Cc2ccccc2[C@@H]1O.
What is the InChIKey of (1R,2R)-2-[4-(dimethylamino)-2-methylphenyl]-1,2-dihydronaphthalen-1-ol?
The InChIKey is JNTHZCJOMILLMF-MOPGFXCFSA-N. The full InChI is InChI=1S/C19H21NO/c1-13-12-15(20(2)3)9-11-16(13)18-10-8-14-6-4-5-7-17(14)19(18)21/h4-12,18-19,21H,1-3H3/t18-,19+/m1/s1.
What are the key properties of (1R,2R)-2-[4-(dimethylamino)-2-methylphenyl]-1,2-dihydronaphthalen-1-ol?
(1R,2R)-2-[4-(dimethylamino)-2-methylphenyl]-1,2-dihydronaphthalen-1-ol has a molecular weight of 279.38 g/mol, XLogP of 3.91, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2R)-2-[4-(dimethylamino)-2-methylphenyl]-1,2-dihydronaphthalen-1-ol is sourced from PubChem (CID 134960838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).