C19H21NO — CID 134960838
(1R,2R)-2-[4-(dimethylamino)-2-methylphenyl]-1,2-dihydronaphthalen-1-ol (PubChem CID 134960838) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is (1R,2R)-2-[4-(dimethylamino)-2-methylphenyl]-1,2-dihydronaphthalen-1-ol.
| Compound Name | (1R,2R)-2-[4-(dimethylamino)-2-methylphenyl]-1,2-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 134960838 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (1R,2R)-2-[4-(dimethylamino)-2-methylphenyl]-1,2-dihydronaphthalen-1-ol |
| SMILES | Cc1cc(N(C)C)ccc1[C@H]1C=Cc2ccccc2[C@@H]1O |
| InChI | InChI=1S/C19H21NO/c1-13-12-15(20(2)3)9-11-16(13)18-10-8-14-6-4-5-7-17(14)19(18)21/h4-12,18-19,21H,1-3H3/t18-,19+/m1/s1 |
| InChIKey | JNTHZCJOMILLMF-MOPGFXCFSA-N |
| XLogP | 3.91 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|