C16H13ClO — CID 174973723
2-(4-chlorophenyl)-1,2-dihydronaphthalen-1-ol (PubChem CID 174973723) has the molecular formula C16H13ClO and a molecular weight of 256.73 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1,2-dihydronaphthalen-1-ol.
| Compound Name | 2-(4-chlorophenyl)-1,2-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 174973723 |
| Molecular Formula | C16H13ClO |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 2-(4-chlorophenyl)-1,2-dihydronaphthalen-1-ol |
| SMILES | OC1c2ccccc2C=CC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H13ClO/c17-13-8-5-12(6-9-13)15-10-7-11-3-1-2-4-14(11)16(15)18/h1-10,15-16,18H |
| InChIKey | ZNEVNWDQVZVQRI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |