C16H12Br2O — CID 11474456
(1S,2R)-6,7-dibromo-2-phenyl-1,2-dihydronaphthalen-1-ol (PubChem CID 11474456) has the molecular formula C16H12Br2O and a molecular weight of 380.08 g/mol. Its IUPAC name is (1S,2R)-6,7-dibromo-2-phenyl-1,2-dihydronaphthalen-1-ol.
| Compound Name | (1S,2R)-6,7-dibromo-2-phenyl-1,2-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 11474456 |
| Molecular Formula | C16H12Br2O |
| Molecular Weight | 380.08 g/mol |
| Exact Mass | 377.93 |
| IUPAC Name | (1S,2R)-6,7-dibromo-2-phenyl-1,2-dihydronaphthalen-1-ol |
| SMILES | O[C@@H]1c2cc(Br)c(Br)cc2C=C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H12Br2O/c17-14-8-11-6-7-12(10-4-2-1-3-5-10)16(19)13(11)9-15(14)18/h1-9,12,16,19H/t12-,16+/m1/s1 |
| InChIKey | GQBVMTNFUCBTDM-WBMJQRKESA-N |
| XLogP | 5.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.08 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |