C18H14O2 — CID 23621324
(10S,11S)-10,11-dihydrobenzo[a]anthracene-10,11-diol (PubChem CID 23621324) has the molecular formula C18H14O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is (10S,11S)-10,11-dihydrobenzo[a]anthracene-10,11-diol.
| Compound Name | (10S,11S)-10,11-dihydrobenzo[a]anthracene-10,11-diol |
|---|---|
| PubChem CID | 23621324 |
| Molecular Formula | C18H14O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | (10S,11S)-10,11-dihydrobenzo[a]anthracene-10,11-diol |
| SMILES | O[C@H]1C=Cc2cc3ccc4ccccc4c3cc2[C@@H]1O |
| InChI | InChI=1S/C18H14O2/c19-17-8-7-13-9-12-6-5-11-3-1-2-4-14(11)15(12)10-16(13)18(17)20/h1-10,17-20H/t17-,18-/m0/s1 |
| InChIKey | QMZBNBYLXIIEFF-ROUUACIJSA-N |
| XLogP | 3.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|