C22H16O2 — CID 19487
(5R,6R)-5,6-dihydronaphtho[1,2-b]phenanthrene-5,6-diol (PubChem CID 19487) has the molecular formula C22H16O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is (5R,6R)-5,6-dihydronaphtho[1,2-b]phenanthrene-5,6-diol.
| Compound Name | (5R,6R)-5,6-dihydronaphtho[1,2-b]phenanthrene-5,6-diol |
|---|---|
| PubChem CID | 19487 |
| Molecular Formula | C22H16O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (5R,6R)-5,6-dihydronaphtho[1,2-b]phenanthrene-5,6-diol |
| SMILES | O[C@@H]1c2ccccc2-c2cc3ccc4ccccc4c3cc2[C@H]1O |
| InChI | InChI=1S/C22H16O2/c23-21-17-8-4-3-7-16(17)19-11-14-10-9-13-5-1-2-6-15(13)18(14)12-20(19)22(21)24/h1-12,21-24H/t21-,22-/m1/s1 |
| InChIKey | RDJMBJBJQWPDEA-FGZHOGPDSA-N |
| XLogP | 4.74 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|