About phenanthrene-2,3-diol
phenanthrene-2,3-diol (PubChem CID 23048019) has the molecular formula C14H10O2
and a molecular weight of 210.23 g/mol. Its IUPAC name is phenanthrene-2,3-diol.
Molecular Properties
| Compound Name | phenanthrene-2,3-diol |
| PubChem CID | 23048019 |
| Molecular Formula | C14H10O2 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | phenanthrene-2,3-diol |
| SMILES | Oc1cc2ccc3ccccc3c2cc1O |
| InChI | InChI=1S/C14H10O2/c15-13-7-10-6-5-9-3-1-2-4-11(9)12(10)8-14(13)16/h1-8,15-16H |
| InChIKey | DEPKPGBSQLCQKX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze phenanthrene-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthrene-2,3-diol?
The IUPAC name of phenanthrene-2,3-diol (CID 23048019) is phenanthrene-2,3-diol.
What is the SMILES notation for phenanthrene-2,3-diol?
The canonical SMILES for phenanthrene-2,3-diol is Oc1cc2ccc3ccccc3c2cc1O.
What is the InChIKey of phenanthrene-2,3-diol?
The InChIKey is DEPKPGBSQLCQKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O2/c15-13-7-10-6-5-9-3-1-2-4-11(9)12(10)8-14(13)16/h1-8,15-16H.
What are the key properties of phenanthrene-2,3-diol?
phenanthrene-2,3-diol has a molecular weight of 210.23 g/mol, XLogP of 3.40, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthrene-2,3-diol is sourced from PubChem (CID 23048019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).