About phenanthren-3-ol
phenanthren-3-ol (PubChem CID 73057263) has the molecular formula C14H10O
and a molecular weight of 200.19 g/mol. Its IUPAC name is phenanthren-3-ol.
Molecular Properties
| Compound Name | phenanthren-3-ol |
| PubChem CID | 73057263 |
| Molecular Formula | C14H10O |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | phenanthren-3-ol |
| SMILES | Oc1ccc2cc[13c]3[13cH][13cH][13cH][13cH][13c]3c2c1 |
| InChI | InChI=1S/C14H10O/c15-12-8-7-11-6-5-10-3-1-2-4-13(10)14(11)9-12/h1-9,15H/i1+1,2+1,3+1,4+1,10+1,13+1 |
| InChIKey | NGPOABOEXMDQBT-JOCKUXRRSA-N |
| XLogP | 3.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze phenanthren-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthren-3-ol?
The IUPAC name of phenanthren-3-ol (CID 73057263) is phenanthren-3-ol.
What is the SMILES notation for phenanthren-3-ol?
The canonical SMILES for phenanthren-3-ol is Oc1ccc2cc[13c]3[13cH][13cH][13cH][13cH][13c]3c2c1.
What is the InChIKey of phenanthren-3-ol?
The InChIKey is NGPOABOEXMDQBT-JOCKUXRRSA-N. The full InChI is InChI=1S/C14H10O/c15-12-8-7-11-6-5-10-3-1-2-4-13(10)14(11)9-12/h1-9,15H/i1+1,2+1,3+1,4+1,10+1,13+1.
What are the key properties of phenanthren-3-ol?
phenanthren-3-ol has a molecular weight of 200.19 g/mol, XLogP of 3.70, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthren-3-ol is sourced from PubChem (CID 73057263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).