C22H18O4 — CID 10712585
(7R,8R,18S,19S)-pentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),2,4(9),5,10,12,15,17(22),20-nonaene-7,8,18,19-tetrol (PubChem CID 10712585) has the molecular formula C22H18O4 and a molecular weight of 346.38 g/mol. Its IUPAC name is (7R,8R,18S,19S)-pentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),2,4(9),5,10,12,15,17(22),20-nonaene-7,8,18,19-tetrol.
| Compound Name | (7R,8R,18S,19S)-pentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),2,4(9),5,10,12,15,17(22),20-nonaene-7,8,18,19-tetrol |
|---|---|
| PubChem CID | 10712585 |
| Molecular Formula | C22H18O4 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (7R,8R,18S,19S)-pentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),2,4(9),5,10,12,15,17(22),20-nonaene-7,8,18,19-tetrol |
| SMILES | O[C@@H]1C=Cc2c(ccc3cc4ccc5c(c4cc23)C=C[C@H](O)[C@H]5O)[C@H]1O |
| InChI | InChI=1S/C22H18O4/c23-19-7-5-13-15(21(19)25)3-1-11-9-12-2-4-16-14(18(12)10-17(11)13)6-8-20(24)22(16)26/h1-10,19-26H/t19-,20+,21-,22+ |
| InChIKey | VWENAZFQXANLOD-COPRSSIGSA-N |
| XLogP | 2.84 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|