C24H18O4 — CID 15418685
(13S,14S,18R,19R)-hexacyclo[10.10.2.02,7.08,24.015,23.017,22]tetracosa-1(22),2,4,6,8(24),9,11,15(23),16,20-decaene-13,14,18,19-tetrol (PubChem CID 15418685) has the molecular formula C24H18O4 and a molecular weight of 370.40 g/mol. Its IUPAC name is (13S,14S,18R,19R)-hexacyclo[10.10.2.02,7.08,24.015,23.017,22]tetracosa-1(22),2,4,6,8(24),9,11,15(23),16,20-decaene-13,14,18,19-tetrol.
| Compound Name | (13S,14S,18R,19R)-hexacyclo[10.10.2.02,7.08,24.015,23.017,22]tetracosa-1(22),2,4,6,8(24),9,11,15(23),16,20-decaene-13,14,18,19-tetrol |
|---|---|
| PubChem CID | 15418685 |
| Molecular Formula | C24H18O4 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | (13S,14S,18R,19R)-hexacyclo[10.10.2.02,7.08,24.015,23.017,22]tetracosa-1(22),2,4,6,8(24),9,11,15(23),16,20-decaene-13,14,18,19-tetrol |
| SMILES | O[C@@H]1C=Cc2c(cc3c4c5c(cccc5c5ccccc5c24)[C@H](O)[C@H]3O)[C@H]1O |
| InChI | InChI=1S/C24H18O4/c25-18-9-8-14-16(22(18)26)10-17-21-19(14)12-5-2-1-4-11(12)13-6-3-7-15(20(13)21)23(27)24(17)28/h1-10,18,22-28H/t18-,22-,23+,24+/m1/s1 |
| InChIKey | HXMUFRFKNWVGSR-LKDDOFHYSA-N |
| XLogP | 3.65 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|